C20H19N3O4S — CID 46261528
methyl 2-[(2-morpholin-4-yl-1,3-benzothiazole-6-carbonyl)amino]benzoate (PubChem CID 46261528) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is methyl 2-[(2-morpholin-4-yl-1,3-benzothiazole-6-carbonyl)amino]benzoate.
| Compound Name | methyl 2-[(2-morpholin-4-yl-1,3-benzothiazole-6-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 46261528 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 2-[(2-morpholin-4-yl-1,3-benzothiazole-6-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C20H19N3O4S/c1-26-19(25)14-4-2-3-5-15(14)21-18(24)13-6-7-16-17(12-13)28-20(22-16)23-8-10-27-11-9-23/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | POIPRPIOLJEWNZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |