C14H9N3O3Se — CID 17313158
2-(2,1,3-benzoselenadiazole-5-carbonylamino)benzoic acid (PubChem CID 17313158) has the molecular formula C14H9N3O3Se and a molecular weight of 346.20 g/mol. Its IUPAC name is 2-(2,1,3-benzoselenadiazole-5-carbonylamino)benzoic acid.
| Compound Name | 2-(2,1,3-benzoselenadiazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 17313158 |
| Molecular Formula | C14H9N3O3Se |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(2,1,3-benzoselenadiazole-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc2n[se]nc2c1 |
| InChI | InChI=1S/C14H9N3O3Se/c18-13(8-5-6-11-12(7-8)17-21-16-11)15-10-4-2-1-3-9(10)14(19)20/h1-7H,(H,15,18)(H,19,20) |
| InChIKey | PHUSNWRZITZFOC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|