C20H20ClN3O5 — CID 8537822
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-chlorobenzoyl)amino]benzoate (PubChem CID 8537822) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-chlorobenzoyl)amino]benzoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-chlorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 8537822 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-chlorobenzoyl)amino]benzoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O5/c1-2-11-22-20(28)24-17(25)12-29-19(27)15-5-3-4-6-16(15)23-18(26)13-7-9-14(21)10-8-13/h3-10H,2,11-12H2,1H3,(H,23,26)(H2,22,24,25,28) |
| InChIKey | QOCKROBMRYSUSN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |