C15H10BrClF3NO4 — CID 3389681
[1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-bromofuran-2-carboxylate (PubChem CID 3389681) has the molecular formula C15H10BrClF3NO4 and a molecular weight of 440.60 g/mol. Its IUPAC name is [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-bromofuran-2-carboxylate.
| Compound Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 3389681 |
| Molecular Formula | C15H10BrClF3NO4 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | [1-[2-chloro-5-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 5-bromofuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(Br)o1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H10BrClF3NO4/c1-7(24-14(23)11-4-5-12(16)25-11)13(22)21-10-6-8(15(18,19)20)2-3-9(10)17/h2-7H,1H3,(H,21,22) |
| InChIKey | JJLPBZGVJHBKRM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |