C17H16ClNO4 — CID 46624947
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 46624947) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 46624947 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | C=CCNC(=O)C(C)OC(=O)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C17H16ClNO4/c1-3-10-19-16(20)11(2)22-17(21)15-9-8-14(23-15)12-6-4-5-7-13(12)18/h3-9,11H,1,10H2,2H3,(H,19,20) |
| InChIKey | BXEIAFLAFDIEEL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|