C23H17F4NO4 — CID 42973466
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 42973466) has the molecular formula C23H17F4NO4 and a molecular weight of 447.38 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 42973466 |
| Molecular Formula | C23H17F4NO4 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | CC(OC(=O)c1ccccc1OCc1ccc(F)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H17F4NO4/c1-13(22(29)28-18-11-10-17(25)20(26)21(18)27)32-23(30)16-4-2-3-5-19(16)31-12-14-6-8-15(24)9-7-14/h2-11,13H,12H2,1H3,(H,28,29) |
| InChIKey | HNUBLLBOUSSHQH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|