C18H13F3N2O3 — CID 7493005
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1H-indole-3-carboxylate (PubChem CID 7493005) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1H-indole-3-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7493005 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1H-indole-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1c[nH]c2ccccc12)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13F3N2O3/c1-9(17(24)23-14-7-6-12(19)15(20)16(14)21)26-18(25)11-8-22-13-5-3-2-4-10(11)13/h2-9,22H,1H3,(H,23,24)/t9-/m0/s1 |
| InChIKey | DRXFWAHCBWWMAW-VIFPVBQESA-N |
| XLogP | 3.77 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|