C17H15F3N2O5S — CID 16519183
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(methanesulfonamido)benzoate (PubChem CID 16519183) has the molecular formula C17H15F3N2O5S and a molecular weight of 416.38 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(methanesulfonamido)benzoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16519183 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(methanesulfonamido)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NS(C)(=O)=O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H15F3N2O5S/c1-9(16(23)21-13-8-7-11(18)14(19)15(13)20)27-17(24)10-5-3-4-6-12(10)22-28(2,25)26/h3-9,22H,1-2H3,(H,21,23) |
| InChIKey | MENDBNJJTIJPFE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|