C17H16FNO5S — CID 7740719
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(methanesulfonamido)benzoate (PubChem CID 7740719) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(methanesulfonamido)benzoate.
| Compound Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 7740719 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-(methanesulfonamido)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1NS(C)(=O)=O)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO5S/c1-11(16(20)12-7-9-13(18)10-8-12)24-17(21)14-5-3-4-6-15(14)19-25(2,22)23/h3-11,19H,1-2H3/t11-/m0/s1 |
| InChIKey | MVZHRYOKUUIGDZ-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |