C21H19F3N2O2 — CID 108798031
3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 108798031) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 108798031 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(C)c1ccc(-c2cnc(CCC(=O)Nc3ccc(F)c(F)c3F)o2)cc1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-12(2)13-3-5-14(6-4-13)17-11-25-19(28-17)10-9-18(27)26-16-8-7-15(22)20(23)21(16)24/h3-8,11-12H,9-10H2,1-2H3,(H,26,27) |
| InChIKey | RDVZQKLOWMZPPB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|