C25H31N3O2 — CID 108784918
N-[4-(diethylamino)phenyl]-3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]propanamide (PubChem CID 108784918) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]propanamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]propanamide |
|---|---|
| PubChem CID | 108784918 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3-[5-(4-propan-2-ylphenyl)-1,3-oxazol-2-yl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCc2ncc(-c3ccc(C(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-5-28(6-2)22-13-11-21(12-14-22)27-24(29)15-16-25-26-17-23(30-25)20-9-7-19(8-10-20)18(3)4/h7-14,17-18H,5-6,15-16H2,1-4H3,(H,27,29) |
| InChIKey | WSMJCPIIZHJBFL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|