C16H22Cl3N3O2 — CID 119429994
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[3-(methylamino)propyl]propanamide;dihydrochloride (PubChem CID 119429994) has the molecular formula C16H22Cl3N3O2 and a molecular weight of 394.73 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[3-(methylamino)propyl]propanamide;dihydrochloride.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[3-(methylamino)propyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119429994 |
| Molecular Formula | C16H22Cl3N3O2 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[3-(methylamino)propyl]propanamide;dihydrochloride |
| SMILES | CNCCCNC(=O)CCc1ncc(-c2ccccc2Cl)o1.Cl.Cl |
| InChI | InChI=1S/C16H20ClN3O2.2ClH/c1-18-9-4-10-19-15(21)7-8-16-20-11-14(22-16)12-5-2-3-6-13(12)17;;/h2-3,5-6,11,18H,4,7-10H2,1H3,(H,19,21);2*1H |
| InChIKey | GQIDFUODNTWGAD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|