C22H20Cl2FN3O3 — CID 33329663
N-[2-[3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 33329663) has the molecular formula C22H20Cl2FN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is N-[2-[3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 33329663 |
| Molecular Formula | C22H20Cl2FN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[2-[3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)CCc2ncc(-c3ccc(Cl)cc3Cl)o2)cc1F |
| InChI | InChI=1S/C22H20Cl2FN3O3/c1-13-2-3-14(10-18(13)25)22(30)27-9-8-26-20(29)6-7-21-28-12-19(31-21)16-5-4-15(23)11-17(16)24/h2-5,10-12H,6-9H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | XHLSTMOYHXCLGT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|