C13H12Cl2N2O3 — CID 33103637
3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-methoxypropanamide (PubChem CID 33103637) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-methoxypropanamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-methoxypropanamide |
|---|---|
| PubChem CID | 33103637 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)-1,3-oxazol-2-yl]-N-methoxypropanamide |
| SMILES | CONC(=O)CCc1ncc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C13H12Cl2N2O3/c1-19-17-12(18)4-5-13-16-7-11(20-13)9-3-2-8(14)6-10(9)15/h2-3,6-7H,4-5H2,1H3,(H,17,18) |
| InChIKey | LZQAAAFQTLWSQY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|