C15H12N4O2 — CID 22431716
5-phenyl-N-(pyridin-3-ylmethyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 22431716) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-phenyl-N-(pyridin-3-ylmethyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-phenyl-N-(pyridin-3-ylmethyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 22431716 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-phenyl-N-(pyridin-3-ylmethyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H12N4O2/c20-13(17-10-11-5-4-8-16-9-11)15-19-18-14(21-15)12-6-2-1-3-7-12/h1-9H,10H2,(H,17,20) |
| InChIKey | XRQWBOHOBHSLQV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |