C13H13N3O2 — CID 110390874
(5-phenyl-1,3,4-oxadiazol-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 110390874) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 110390874 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1nnc(-c2ccccc2)o1)N1CCCC1 |
| InChI | InChI=1S/C13H13N3O2/c17-13(16-8-4-5-9-16)12-15-14-11(18-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | BOYPIMPQYROEMP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |