C21H20N2O3 — CID 75402652
cyclopentyl 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 75402652) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is cyclopentyl 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoate.
| Compound Name | cyclopentyl 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 75402652 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | cyclopentyl 4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoate |
| SMILES | Cc1ccccc1-c1nnc(-c2ccc(C(=O)OC3CCCC3)cc2)o1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-6-2-5-9-18(14)20-23-22-19(26-20)15-10-12-16(13-11-15)21(24)25-17-7-3-4-8-17/h2,5-6,9-13,17H,3-4,7-8H2,1H3 |
| InChIKey | XFPTVGUABHIEQU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |