C23H25N3O2 — CID 26002230
N-cycloheptyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 26002230) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-cycloheptyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-cycloheptyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 26002230 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-cycloheptyl-4-[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1-c1nnc(-c2ccc(C(=O)NC3CCCCCC3)cc2)o1 |
| InChI | InChI=1S/C23H25N3O2/c1-16-8-6-7-11-20(16)23-26-25-22(28-23)18-14-12-17(13-15-18)21(27)24-19-9-4-2-3-5-10-19/h6-8,11-15,19H,2-5,9-10H2,1H3,(H,24,27) |
| InChIKey | XPOQTUTVQDYXII-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |