C22H19N3O5S — CID 56552534
3-(benzenesulfonylmethyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]furan-2-carboxamide (PubChem CID 56552534) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]furan-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56552534 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]furan-2-carboxamide |
| SMILES | COc1ccccc1-c1cc(NC(=O)c2occc2CS(=O)(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H19N3O5S/c1-29-19-10-6-5-9-17(19)18-13-20(25-24-18)23-22(26)21-15(11-12-30-21)14-31(27,28)16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H2,23,24,25,26) |
| InChIKey | FCQXRRMDCMGWSC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |