C28H21NO6S — CID 38087980
methyl 3-[2-[3-[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]phenyl]ethynyl]benzoate (PubChem CID 38087980) has the molecular formula C28H21NO6S and a molecular weight of 499.54 g/mol. Its IUPAC name is methyl 3-[2-[3-[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 38087980 |
| Molecular Formula | C28H21NO6S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | methyl 3-[2-[3-[[3-(benzenesulfonylmethyl)furan-2-carbonyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)c3occc3CS(=O)(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H21NO6S/c1-34-28(31)22-9-5-7-20(17-22)13-14-21-8-6-10-24(18-21)29-27(30)26-23(15-16-35-26)19-36(32,33)25-11-3-2-4-12-25/h2-12,15-18H,19H2,1H3,(H,29,30) |
| InChIKey | IVUYUVFQNAEKNZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|