C23H24N2O7S — CID 46665405
3-(benzenesulfonylmethyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]furan-2-carbohydrazide (PubChem CID 46665405) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]furan-2-carbohydrazide.
| Compound Name | 3-(benzenesulfonylmethyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 46665405 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]furan-2-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2occc2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O7S/c1-3-30-18-9-11-19(12-10-18)32-16(2)22(26)24-25-23(27)21-17(13-14-31-21)15-33(28,29)20-7-5-4-6-8-20/h4-14,16H,3,15H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XDTUMCDNCNDRAL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|