C21H18F3NO5S — CID 55611522
3-(benzenesulfonylmethyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide (PubChem CID 55611522) has the molecular formula C21H18F3NO5S and a molecular weight of 453.44 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55611522 |
| Molecular Formula | C21H18F3NO5S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1occc1CS(=O)(=O)c1ccccc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3NO5S/c1-14(15-7-9-17(10-8-15)30-21(22,23)24)25-20(26)19-16(11-12-29-19)13-31(27,28)18-5-3-2-4-6-18/h2-12,14H,13H2,1H3,(H,25,26) |
| InChIKey | RTYCLEHBGRXANT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |