C24H23NO7S — CID 55467166
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55467166) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55467166 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)c2occc2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO7S/c1-2-6-22(27)25-19-11-9-17(10-12-19)21(26)15-32-24(28)23-18(13-14-31-23)16-33(29,30)20-7-4-3-5-8-20/h3-5,7-14H,2,6,15-16H2,1H3,(H,25,27) |
| InChIKey | UCFKHGDDQQVNRN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |