C10H12O7S — CID 43617863
3-[(3-methoxy-3-oxopropyl)sulfonylmethyl]furan-2-carboxylic acid (PubChem CID 43617863) has the molecular formula C10H12O7S and a molecular weight of 276.27 g/mol. Its IUPAC name is 3-[(3-methoxy-3-oxopropyl)sulfonylmethyl]furan-2-carboxylic acid.
| Compound Name | 3-[(3-methoxy-3-oxopropyl)sulfonylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43617863 |
| Molecular Formula | C10H12O7S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-[(3-methoxy-3-oxopropyl)sulfonylmethyl]furan-2-carboxylic acid |
| SMILES | COC(=O)CCS(=O)(=O)Cc1ccoc1C(=O)O |
| InChI | InChI=1S/C10H12O7S/c1-16-8(11)3-5-18(14,15)6-7-2-4-17-9(7)10(12)13/h2,4H,3,5-6H2,1H3,(H,12,13) |
| InChIKey | BFXBJGSNVJBVTE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |