C11H14O7S — CID 43621018
5-[(3-methoxy-3-oxopropyl)sulfonylmethyl]-3-methylfuran-2-carboxylic acid (PubChem CID 43621018) has the molecular formula C11H14O7S and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-[(3-methoxy-3-oxopropyl)sulfonylmethyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(3-methoxy-3-oxopropyl)sulfonylmethyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43621018 |
| Molecular Formula | C11H14O7S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-[(3-methoxy-3-oxopropyl)sulfonylmethyl]-3-methylfuran-2-carboxylic acid |
| SMILES | COC(=O)CCS(=O)(=O)Cc1cc(C)c(C(=O)O)o1 |
| InChI | InChI=1S/C11H14O7S/c1-7-5-8(18-10(7)11(13)14)6-19(15,16)4-3-9(12)17-2/h5H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | PYUHSLTUFJDRSH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |