C11H16O5S — CID 43621008
5-(butan-2-ylsulfonylmethyl)-3-methylfuran-2-carboxylic acid (PubChem CID 43621008) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 5-(butan-2-ylsulfonylmethyl)-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-(butan-2-ylsulfonylmethyl)-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43621008 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-(butan-2-ylsulfonylmethyl)-3-methylfuran-2-carboxylic acid |
| SMILES | CCC(C)S(=O)(=O)Cc1cc(C)c(C(=O)O)o1 |
| InChI | InChI=1S/C11H16O5S/c1-4-8(3)17(14,15)6-9-5-7(2)10(16-9)11(12)13/h5,8H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | MAUVLRUIUBZKCS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |