C11H10O5S2 — CID 43621002
3-methyl-5-(thiophen-2-ylsulfonylmethyl)furan-2-carboxylic acid (PubChem CID 43621002) has the molecular formula C11H10O5S2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-methyl-5-(thiophen-2-ylsulfonylmethyl)furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-(thiophen-2-ylsulfonylmethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43621002 |
| Molecular Formula | C11H10O5S2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 3-methyl-5-(thiophen-2-ylsulfonylmethyl)furan-2-carboxylic acid |
| SMILES | Cc1cc(CS(=O)(=O)c2cccs2)oc1C(=O)O |
| InChI | InChI=1S/C11H10O5S2/c1-7-5-8(16-10(7)11(12)13)6-18(14,15)9-3-2-4-17-9/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | BHILJLCLBHZNCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |