4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid

C9H7NO4S3 — CID 43664544

IUPAC4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(CS(=O)(=O)c2cccs2)cs1
InChIInChI=1S/C9H7NO4S3/c11-9(12)8-10-6(4-16-8)5-17(13,14)7-2-1-3-15-7/h1-4H,5H2,(H,11,12)
InChIKeyAPLVLLKSHVENLK-UHFFFAOYSA-N
MW289.36 g/mol
LogP1.88
Rot. Bonds4

About 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid

4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 43664544) has the molecular formula C9H7NO4S3 and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid
PubChem CID43664544
Molecular FormulaC9H7NO4S3
Molecular Weight289.36 g/mol
Exact Mass288.95
IUPAC Name4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(CS(=O)(=O)c2cccs2)cs1
InChIInChI=1S/C9H7NO4S3/c11-9(12)8-10-6(4-16-8)5-17(13,14)7-2-1-3-15-7/h1-4H,5H2,(H,11,12)
InChIKeyAPLVLLKSHVENLK-UHFFFAOYSA-N
XLogP1.88
TPSA84.33 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.36
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid (CID 43664544) is 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(CS(=O)(=O)c2cccs2)cs1.
What is the InChIKey of 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid?
The InChIKey is APLVLLKSHVENLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4S3/c11-9(12)8-10-6(4-16-8)5-17(13,14)7-2-1-3-15-7/h1-4H,5H2,(H,11,12).
What are the key properties of 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid?
4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid has a molecular weight of 289.36 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thiophen-2-ylsulfonylmethyl)-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 43664544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).