C11H10O4S2 — CID 61303150
3-methyl-5-(thiophen-2-ylsulfinylmethyl)furan-2-carboxylic acid (PubChem CID 61303150) has the molecular formula C11H10O4S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-methyl-5-(thiophen-2-ylsulfinylmethyl)furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-(thiophen-2-ylsulfinylmethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 61303150 |
| Molecular Formula | C11H10O4S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 3-methyl-5-(thiophen-2-ylsulfinylmethyl)furan-2-carboxylic acid |
| SMILES | Cc1cc(CS(=O)c2cccs2)oc1C(=O)O |
| InChI | InChI=1S/C11H10O4S2/c1-7-5-8(15-10(7)11(12)13)6-17(14)9-3-2-4-16-9/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | XXFLVLKFIPUKGI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |