C14H14O5S — CID 61301771
5-[(3-methoxyphenyl)sulfinylmethyl]-3-methylfuran-2-carboxylic acid (PubChem CID 61301771) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)sulfinylmethyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(3-methoxyphenyl)sulfinylmethyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 61301771 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[(3-methoxyphenyl)sulfinylmethyl]-3-methylfuran-2-carboxylic acid |
| SMILES | COc1cccc(S(=O)Cc2cc(C)c(C(=O)O)o2)c1 |
| InChI | InChI=1S/C14H14O5S/c1-9-6-11(19-13(9)14(15)16)8-20(17)12-5-3-4-10(7-12)18-2/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | UJGGNHHUBOQWRW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |