C13H12O4S — CID 113430030
5-[(3-hydroxyphenyl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid (PubChem CID 113430030) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is 5-[(3-hydroxyphenyl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(3-hydroxyphenyl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 113430030 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-[(3-hydroxyphenyl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(CSc2cccc(O)c2)oc1C(=O)O |
| InChI | InChI=1S/C13H12O4S/c1-8-5-10(17-12(8)13(15)16)7-18-11-4-2-3-9(14)6-11/h2-6,14H,7H2,1H3,(H,15,16) |
| InChIKey | UZYUOPZUVOEUPX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |