C11H12N2O2S — CID 104590639
3-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol (PubChem CID 104590639) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol.
| Compound Name | 3-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 104590639 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]phenol |
| SMILES | CCc1nnc(CSc2cccc(O)c2)o1 |
| InChI | InChI=1S/C11H12N2O2S/c1-2-10-12-13-11(15-10)7-16-9-5-3-4-8(14)6-9/h3-6,14H,2,7H2,1H3 |
| InChIKey | KJNZRMCHRRBOEH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |