C12H16O6S — CID 107746487
3-methyl-5-[(2-methyloxolan-3-yl)sulfonylmethyl]furan-2-carboxylic acid (PubChem CID 107746487) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-methyl-5-[(2-methyloxolan-3-yl)sulfonylmethyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(2-methyloxolan-3-yl)sulfonylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107746487 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-methyl-5-[(2-methyloxolan-3-yl)sulfonylmethyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(CS(=O)(=O)C2CCOC2C)oc1C(=O)O |
| InChI | InChI=1S/C12H16O6S/c1-7-5-9(18-11(7)12(13)14)6-19(15,16)10-3-4-17-8(10)2/h5,8,10H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | AWXCCCMAQGYYCO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |