C10H12N2O6S — CID 102974089
4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]pyrimidine-5-carboxylic acid (PubChem CID 102974089) has the molecular formula C10H12N2O6S and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102974089 |
| Molecular Formula | C10H12N2O6S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]pyrimidine-5-carboxylic acid |
| SMILES | COC(=O)CCS(=O)(=O)Cc1ncncc1C(=O)O |
| InChI | InChI=1S/C10H12N2O6S/c1-18-9(13)2-3-19(16,17)5-8-7(10(14)15)4-11-6-12-8/h4,6H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | WNUXMDVVPFQELA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |