C9H12N2O4S — CID 102974083
4-(propylsulfonylmethyl)pyrimidine-5-carboxylic acid (PubChem CID 102974083) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-(propylsulfonylmethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(propylsulfonylmethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102974083 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-(propylsulfonylmethyl)pyrimidine-5-carboxylic acid |
| SMILES | CCCS(=O)(=O)Cc1ncncc1C(=O)O |
| InChI | InChI=1S/C9H12N2O4S/c1-2-3-16(14,15)5-8-7(9(12)13)4-10-6-11-8/h4,6H,2-3,5H2,1H3,(H,12,13) |
| InChIKey | OHJGVHHZBPAKRO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |