C9H13NO4S2 — CID 82423477
2-[2-(propylsulfonylmethyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 82423477) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[2-(propylsulfonylmethyl)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(propylsulfonylmethyl)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 82423477 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-[2-(propylsulfonylmethyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | CCCS(=O)(=O)Cc1ncc(CC(=O)O)s1 |
| InChI | InChI=1S/C9H13NO4S2/c1-2-3-16(13,14)6-8-10-5-7(15-8)4-9(11)12/h5H,2-4,6H2,1H3,(H,11,12) |
| InChIKey | IVNLTBGSPISBDO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |