C10H13NO3 — CID 103264913
3-[(but-3-en-2-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 103264913) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-[(but-3-en-2-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(but-3-en-2-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103264913 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-[(but-3-en-2-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | C=CC(C)NCc1ccoc1C(=O)O |
| InChI | InChI=1S/C10H13NO3/c1-3-7(2)11-6-8-4-5-14-9(8)10(12)13/h3-5,7,11H,1,6H2,2H3,(H,12,13) |
| InChIKey | LQELYBRJKPDQNQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|