C11H17NO3S — CID 103265840
3-[(4-methylsulfanylbutan-2-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 103265840) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[(4-methylsulfanylbutan-2-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(4-methylsulfanylbutan-2-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103265840 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-[(4-methylsulfanylbutan-2-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | CSCCC(C)NCc1ccoc1C(=O)O |
| InChI | InChI=1S/C11H17NO3S/c1-8(4-6-16-2)12-7-9-3-5-15-10(9)11(13)14/h3,5,8,12H,4,6-7H2,1-2H3,(H,13,14) |
| InChIKey | YOPVBWJMSGVNGP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |