C13H17N2O4P — CID 167876412
2-(diethoxyphosphorylmethyl)-3H-quinazolin-4-one (PubChem CID 167876412) has the molecular formula C13H17N2O4P and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-(diethoxyphosphorylmethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(diethoxyphosphorylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167876412 |
| Molecular Formula | C13H17N2O4P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(diethoxyphosphorylmethyl)-3H-quinazolin-4-one |
| SMILES | CCOP(=O)(Cc1nc2ccccc2c(=O)[nH]1)OCC |
| InChI | InChI=1S/C13H17N2O4P/c1-3-18-20(17,19-4-2)9-12-14-11-8-6-5-7-10(11)13(16)15-12/h5-8H,3-4,9H2,1-2H3,(H,14,15,16) |
| InChIKey | VLINVMKQYXMDRB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|