C17H19ClN4O5S — CID 50889666
N-[4-[(5-chloro-2-methoxyphenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide (PubChem CID 50889666) has the molecular formula C17H19ClN4O5S and a molecular weight of 426.88 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-methoxyphenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(5-chloro-2-methoxyphenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 50889666 |
| Molecular Formula | C17H19ClN4O5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[4-[(5-chloro-2-methoxyphenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NN)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H19ClN4O5S/c1-11(23)20-13-4-6-14(7-5-13)28(25,26)22(10-17(24)21-19)15-9-12(18)3-8-16(15)27-2/h3-9H,10,19H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FWTKOMJZDCLMOS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|