C23H22ClIN2O6S — CID 43891744
2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-(4-iodophenyl)acetamide (PubChem CID 43891744) has the molecular formula C23H22ClIN2O6S and a molecular weight of 616.86 g/mol. Its IUPAC name is 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 43891744 |
| Molecular Formula | C23H22ClIN2O6S |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 615.99 |
| IUPAC Name | 2-(5-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-2-methoxyanilino)-N-(4-iodophenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(I)cc2)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C23H22ClIN2O6S/c1-31-20-10-4-15(24)12-19(20)27(14-23(28)26-17-7-5-16(25)6-8-17)34(29,30)18-9-11-21(32-2)22(13-18)33-3/h4-13H,14H2,1-3H3,(H,26,28) |
| InChIKey | LFCUQDFCUMATRH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|