C24H22Cl2N2O3S — CID 2448420
4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(2,5-dimethylphenyl)benzamide (PubChem CID 2448420) has the molecular formula C24H22Cl2N2O3S and a molecular weight of 489.42 g/mol. Its IUPAC name is 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(2,5-dimethylphenyl)benzamide.
| Compound Name | 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(2,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 2448420 |
| Molecular Formula | C24H22Cl2N2O3S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(2,5-dimethylphenyl)benzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cc(C(=O)Nc2cc(C)ccc2C)ccc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O3S/c1-4-13-28(22-8-6-5-7-19(22)25)32(30,31)23-15-18(11-12-20(23)26)24(29)27-21-14-16(2)9-10-17(21)3/h4-12,14-15H,1,13H2,2-3H3,(H,27,29) |
| InChIKey | IVPLTGWZHPDEIT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|