C34H31Cl2N5O3S — CID 167940239
3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide (PubChem CID 167940239) has the molecular formula C34H31Cl2N5O3S and a molecular weight of 660.63 g/mol. Its IUPAC name is 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide.
| Compound Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 167940239 |
| Molecular Formula | C34H31Cl2N5O3S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[2-methyl-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]benzamide |
| SMILES | Cc1ccc(-c2nnc3n2CCCCC3)cc1NC(=O)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C34H31Cl2N5O3S/c1-23-15-16-25(33-39-38-32-14-6-3-9-19-40(32)33)20-29(23)37-34(42)26-17-18-28(36)31(21-26)45(43,44)41(22-24-10-4-2-5-11-24)30-13-8-7-12-27(30)35/h2,4-5,7-8,10-13,15-18,20-21H,3,6,9,14,19,22H2,1H3,(H,37,42) |
| InChIKey | YJUAAFKGNFWXQF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |