C30H29Cl2N3O5S — CID 166345714
3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]benzamide (PubChem CID 166345714) has the molecular formula C30H29Cl2N3O5S and a molecular weight of 614.55 g/mol. Its IUPAC name is 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]benzamide.
| Compound Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 166345714 |
| Molecular Formula | C30H29Cl2N3O5S |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 3-[benzyl-(2-chlorophenyl)sulfamoyl]-4-chloro-N-[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(N2C(=O)CCC2=O)CC1)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C30H29Cl2N3O5S/c31-24-8-4-5-9-26(24)34(19-20-6-2-1-3-7-20)41(39,40)27-18-21(10-15-25(27)32)30(38)33-22-11-13-23(14-12-22)35-28(36)16-17-29(35)37/h1-10,15,18,22-23H,11-14,16-17,19H2,(H,33,38) |
| InChIKey | GMLAUYKHVQKELR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|