C24H27ClN2O5S — CID 42964112
[2-(azepan-1-yl)-2-oxoethyl] 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 42964112) has the molecular formula C24H27ClN2O5S and a molecular weight of 491.01 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42964112 |
| Molecular Formula | C24H27ClN2O5S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)OCC(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C24H27ClN2O5S/c1-2-14-27(20-10-6-5-7-11-20)33(30,31)22-17-19(12-13-21(22)25)24(29)32-18-23(28)26-15-8-3-4-9-16-26/h2,5-7,10-13,17H,1,3-4,8-9,14-16,18H2 |
| InChIKey | RPKYUBPIBZOCQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|