C24H28ClN3O4S — CID 52909917
N-[(3R)-1-[4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperidin-3-yl]propanamide (PubChem CID 52909917) has the molecular formula C24H28ClN3O4S and a molecular weight of 490.03 g/mol. Its IUPAC name is N-[(3R)-1-[4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperidin-3-yl]propanamide.
| Compound Name | N-[(3R)-1-[4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 52909917 |
| Molecular Formula | C24H28ClN3O4S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-[(3R)-1-[4-chloro-3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]piperidin-3-yl]propanamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc(C(=O)N2CCC[C@@H](NC(=O)CC)C2)ccc1Cl |
| InChI | InChI=1S/C24H28ClN3O4S/c1-3-14-28(20-10-6-5-7-11-20)33(31,32)22-16-18(12-13-21(22)25)24(30)27-15-8-9-19(17-27)26-23(29)4-2/h3,5-7,10-13,16,19H,1,4,8-9,14-15,17H2,2H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | VGBHGHISWBSKEJ-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|