C24H25ClN4O3S — CID 55601956
3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)benzamide (PubChem CID 55601956) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)benzamide.
| Compound Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)benzamide |
|---|---|
| PubChem CID | 55601956 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)benzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)NC2CCCc3c2cnn3C)c1 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-3-14-29(23-12-5-4-10-20(23)25)33(31,32)18-9-6-8-17(15-18)24(30)27-21-11-7-13-22-19(21)16-26-28(22)2/h3-6,8-10,12,15-16,21H,1,7,11,13-14H2,2H3,(H,27,30) |
| InChIKey | QTOMKHALFVHMMG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|