C15H21N3O5S — CID 97187419
3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-N-[(3S)-oxolan-3-yl]benzamide (PubChem CID 97187419) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-N-[(3S)-oxolan-3-yl]benzamide.
| Compound Name | 3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-N-[(3S)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 97187419 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-N-[(3S)-oxolan-3-yl]benzamide |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1cccc(C(=O)N[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C15H21N3O5S/c1-18(2)14(19)9-16-24(21,22)13-5-3-4-11(8-13)15(20)17-12-6-7-23-10-12/h3-5,8,12,16H,6-7,9-10H2,1-2H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | PCHZCBKGOBQBHA-LBPRGKRZSA-N |
| XLogP | -0.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |