C17H22N4O4S — CID 97187261
3-[(2,5-dimethylpyrazol-3-yl)methylsulfamoyl]-N-[(3R)-oxolan-3-yl]benzamide (PubChem CID 97187261) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[(2,5-dimethylpyrazol-3-yl)methylsulfamoyl]-N-[(3R)-oxolan-3-yl]benzamide.
| Compound Name | 3-[(2,5-dimethylpyrazol-3-yl)methylsulfamoyl]-N-[(3R)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 97187261 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[(2,5-dimethylpyrazol-3-yl)methylsulfamoyl]-N-[(3R)-oxolan-3-yl]benzamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2cccc(C(=O)N[C@@H]3CCOC3)c2)n(C)n1 |
| InChI | InChI=1S/C17H22N4O4S/c1-12-8-15(21(2)20-12)10-18-26(23,24)16-5-3-4-13(9-16)17(22)19-14-6-7-25-11-14/h3-5,8-9,14,18H,6-7,10-11H2,1-2H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | YFWYHDCYAKERPA-CQSZACIVSA-N |
| XLogP | 0.73 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |