C17H19N3O2 — CID 125174867
3-(4,6-dimethylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide (PubChem CID 125174867) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 125174867 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)-N-[(3S)-oxolan-3-yl]benzamide |
| SMILES | Cc1cc(C)nc(-c2cccc(C(=O)N[C@H]3CCOC3)c2)n1 |
| InChI | InChI=1S/C17H19N3O2/c1-11-8-12(2)19-16(18-11)13-4-3-5-14(9-13)17(21)20-15-6-7-22-10-15/h3-5,8-9,15H,6-7,10H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | HYHNFQAYZLOMPT-HNNXBMFYSA-N |
| XLogP | 2.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |